C19H20N4O2 — CID 72705111
tert-butyl N-[4-(4-aminoquinazolin-6-yl)phenyl]carbamate (PubChem CID 72705111) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is tert-butyl N-[4-(4-aminoquinazolin-6-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-aminoquinazolin-6-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 72705111 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | tert-butyl N-[4-(4-aminoquinazolin-6-yl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2ccc3ncnc(N)c3c2)cc1 |
| InChI | InChI=1S/C19H20N4O2/c1-19(2,3)25-18(24)23-14-7-4-12(5-8-14)13-6-9-16-15(10-13)17(20)22-11-21-16/h4-11H,1-3H3,(H,23,24)(H2,20,21,22) |
| InChIKey | WJPXTPBTIUMFLR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |