C19H20Cl2N2O3S — CID 177193275
(2R)-2-(2,4-dichlorophenyl)-N-(3-sulfamoylphenyl)cyclohexane-1-carboxamide (PubChem CID 177193275) has the molecular formula C19H20Cl2N2O3S and a molecular weight of 427.35 g/mol. Its IUPAC name is (2R)-2-(2,4-dichlorophenyl)-N-(3-sulfamoylphenyl)cyclohexane-1-carboxamide.
| Compound Name | (2R)-2-(2,4-dichlorophenyl)-N-(3-sulfamoylphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 177193275 |
| Molecular Formula | C19H20Cl2N2O3S |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | (2R)-2-(2,4-dichlorophenyl)-N-(3-sulfamoylphenyl)cyclohexane-1-carboxamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)C2CCCC[C@H]2c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C19H20Cl2N2O3S/c20-12-8-9-16(18(21)10-12)15-6-1-2-7-17(15)19(24)23-13-4-3-5-14(11-13)27(22,25)26/h3-5,8-11,15,17H,1-2,6-7H2,(H,23,24)(H2,22,25,26)/t15-,17?/m0/s1 |
| InChIKey | BIZNPQXSLAEGFP-MYJWUSKBSA-N |
| XLogP | 4.55 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |