About ethanol;3-[ethyl(nonyl)amino]propyl 3-methylhexanoate
ethanol;3-[ethyl(nonyl)amino]propyl 3-methylhexanoate (PubChem CID 177193797) has the molecular formula C23H49NO3
and a molecular weight of 387.65 g/mol. Its IUPAC name is ethanol;3-[ethyl(nonyl)amino]propyl 3-methylhexanoate.
Molecular Properties
| Compound Name | ethanol;3-[ethyl(nonyl)amino]propyl 3-methylhexanoate |
| PubChem CID | 177193797 |
| Molecular Formula | C23H49NO3 |
| Molecular Weight | 387.65 g/mol |
| Exact Mass | 387.37 |
| IUPAC Name | ethanol;3-[ethyl(nonyl)amino]propyl 3-methylhexanoate |
| SMILES | CCCCCCCCCN(CC)CCCOC(=O)CC(C)CCC.CCO |
| InChI | InChI=1S/C21H43NO2.C2H6O/c1-5-8-9-10-11-12-13-16-22(7-3)17-14-18-24-21(23)19-20(4)15-6-2;1-2-3/h20H,5-19H2,1-4H3;3H,2H2,1H3 |
| InChIKey | YULYOIOTAWFCBU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethanol;3-[ethyl(nonyl)amino]propyl 3-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;3-[ethyl(nonyl)amino]propyl 3-methylhexanoate?
The IUPAC name of ethanol;3-[ethyl(nonyl)amino]propyl 3-methylhexanoate (CID 177193797) is ethanol;3-[ethyl(nonyl)amino]propyl 3-methylhexanoate.
What is the SMILES notation for ethanol;3-[ethyl(nonyl)amino]propyl 3-methylhexanoate?
The canonical SMILES for ethanol;3-[ethyl(nonyl)amino]propyl 3-methylhexanoate is CCCCCCCCCN(CC)CCCOC(=O)CC(C)CCC.CCO.
What is the InChIKey of ethanol;3-[ethyl(nonyl)amino]propyl 3-methylhexanoate?
The InChIKey is YULYOIOTAWFCBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H43NO2.C2H6O/c1-5-8-9-10-11-12-13-16-22(7-3)17-14-18-24-21(23)19-20(4)15-6-2;1-2-3/h20H,5-19H2,1-4H3;3H,2H2,1H3.
What are the key properties of ethanol;3-[ethyl(nonyl)amino]propyl 3-methylhexanoate?
ethanol;3-[ethyl(nonyl)amino]propyl 3-methylhexanoate has a molecular weight of 387.65 g/mol, XLogP of 5.82, 17 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;3-[ethyl(nonyl)amino]propyl 3-methylhexanoate is sourced from PubChem (CID 177193797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).