C11H21N — CID 177194225
(4,5-diethylcyclohexen-1-yl)methanamine (PubChem CID 177194225) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (4,5-diethylcyclohexen-1-yl)methanamine.
| Compound Name | (4,5-diethylcyclohexen-1-yl)methanamine |
|---|---|
| PubChem CID | 177194225 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (4,5-diethylcyclohexen-1-yl)methanamine |
| SMILES | CCC1CC=C(CN)CC1CC |
| InChI | InChI=1S/C11H21N/c1-3-10-6-5-9(8-12)7-11(10)4-2/h5,10-11H,3-4,6-8,12H2,1-2H3 |
| InChIKey | MDCRVQUMPHTYEL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|