C17H29O7P — CID 10022388
[(1R,6R)-6-(acetyloxymethyl)-4-(diethoxyphosphorylmethyl)cyclohex-3-en-1-yl]methyl acetate (PubChem CID 10022388) has the molecular formula C17H29O7P and a molecular weight of 376.39 g/mol. Its IUPAC name is [(1R,6R)-6-(acetyloxymethyl)-4-(diethoxyphosphorylmethyl)cyclohex-3-en-1-yl]methyl acetate.
| Compound Name | [(1R,6R)-6-(acetyloxymethyl)-4-(diethoxyphosphorylmethyl)cyclohex-3-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10022388 |
| Molecular Formula | C17H29O7P |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [(1R,6R)-6-(acetyloxymethyl)-4-(diethoxyphosphorylmethyl)cyclohex-3-en-1-yl]methyl acetate |
| SMILES | CCOP(=O)(CC1=CC[C@@H](COC(C)=O)[C@H](COC(C)=O)C1)OCC |
| InChI | InChI=1S/C17H29O7P/c1-5-23-25(20,24-6-2)12-15-7-8-16(10-21-13(3)18)17(9-15)11-22-14(4)19/h7,16-17H,5-6,8-12H2,1-4H3/t16-,17-/m0/s1 |
| InChIKey | FIOOJKPQDPXPQT-IRXDYDNUSA-N |
| XLogP | 3.33 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|