C21H24O8S — CID 100942467
[(1S,5R,6S)-4,5,6-triacetyloxy-3-phenylsulfanylcyclohex-3-en-1-yl]methyl acetate (PubChem CID 100942467) has the molecular formula C21H24O8S and a molecular weight of 436.48 g/mol. Its IUPAC name is [(1S,5R,6S)-4,5,6-triacetyloxy-3-phenylsulfanylcyclohex-3-en-1-yl]methyl acetate.
| Compound Name | [(1S,5R,6S)-4,5,6-triacetyloxy-3-phenylsulfanylcyclohex-3-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 100942467 |
| Molecular Formula | C21H24O8S |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | [(1S,5R,6S)-4,5,6-triacetyloxy-3-phenylsulfanylcyclohex-3-en-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CC(Sc2ccccc2)=C(OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H24O8S/c1-12(22)26-11-16-10-18(30-17-8-6-5-7-9-17)20(28-14(3)24)21(29-15(4)25)19(16)27-13(2)23/h5-9,16,19,21H,10-11H2,1-4H3/t16-,19-,21+/m0/s1 |
| InChIKey | HYQZJNMBSPNYMT-NBHGPNQESA-N |
| XLogP | 3.00 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|