C16H20O11 — CID 70003343
[(2S,3R,4R)-2,3,4,5-tetraacetyloxy-3,4-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 70003343) has the molecular formula C16H20O11 and a molecular weight of 388.33 g/mol. Its IUPAC name is [(2S,3R,4R)-2,3,4,5-tetraacetyloxy-3,4-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [(2S,3R,4R)-2,3,4,5-tetraacetyloxy-3,4-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 70003343 |
| Molecular Formula | C16H20O11 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | [(2S,3R,4R)-2,3,4,5-tetraacetyloxy-3,4-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C(OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)O1 |
| InChI | InChI=1S/C16H20O11/c1-7(17)22-6-12-13(23-8(2)18)14(24-9(3)19)15(25-10(4)20)16(27-12)26-11(5)21/h14-16H,6H2,1-5H3/t14-,15+,16+/m0/s1 |
| InChIKey | SHVYLIILYUBOKJ-ARFHVFGLSA-N |
| XLogP | 0.11 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|