C33H37NO11 — CID 163853710
[(2R,3R,4R)-3,4,5-triacetyloxy-2-[3-[[4-(3-hydroxypropoxy)phenyl]methyl]-4-methylindol-1-yl]-3,4-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 163853710) has the molecular formula C33H37NO11 and a molecular weight of 623.66 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4,5-triacetyloxy-2-[3-[[4-(3-hydroxypropoxy)phenyl]methyl]-4-methylindol-1-yl]-3,4-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [(2R,3R,4R)-3,4,5-triacetyloxy-2-[3-[[4-(3-hydroxypropoxy)phenyl]methyl]-4-methylindol-1-yl]-3,4-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 163853710 |
| Molecular Formula | C33H37NO11 |
| Molecular Weight | 623.66 g/mol |
| Exact Mass | 623.24 |
| IUPAC Name | [(2R,3R,4R)-3,4,5-triacetyloxy-2-[3-[[4-(3-hydroxypropoxy)phenyl]methyl]-4-methylindol-1-yl]-3,4-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C(OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](n2cc(Cc3ccc(OCCCO)cc3)c3c(C)cccc32)O1 |
| InChI | InChI=1S/C33H37NO11/c1-19-8-6-9-27-29(19)25(16-24-10-12-26(13-11-24)40-15-7-14-35)17-34(27)33-32(44-23(5)39)31(43-22(4)38)30(42-21(3)37)28(45-33)18-41-20(2)36/h6,8-13,17,31-33,35H,7,14-16,18H2,1-5H3/t31-,32+,33+/m0/s1 |
| InChIKey | OWNPPAFYSJGJPE-WIHCDAFUSA-N |
| XLogP | 4.03 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.66 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|