C35H37NO9 — CID 130331577
[(2R,3S,4R,6R)-3-acetyloxy-2-(1-hydroxyethoxymethyl)-6-[4-methyl-3-(4-phenylmethoxybenzoyl)indol-1-yl]oxan-4-yl] acetate (PubChem CID 130331577) has the molecular formula C35H37NO9 and a molecular weight of 615.68 g/mol. Its IUPAC name is [(2R,3S,4R,6R)-3-acetyloxy-2-(1-hydroxyethoxymethyl)-6-[4-methyl-3-(4-phenylmethoxybenzoyl)indol-1-yl]oxan-4-yl] acetate.
| Compound Name | [(2R,3S,4R,6R)-3-acetyloxy-2-(1-hydroxyethoxymethyl)-6-[4-methyl-3-(4-phenylmethoxybenzoyl)indol-1-yl]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 130331577 |
| Molecular Formula | C35H37NO9 |
| Molecular Weight | 615.68 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | [(2R,3S,4R,6R)-3-acetyloxy-2-(1-hydroxyethoxymethyl)-6-[4-methyl-3-(4-phenylmethoxybenzoyl)indol-1-yl]oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)C[C@H](n2cc(C(=O)c3ccc(OCc4ccccc4)cc3)c3c(C)cccc32)O[C@@H]1COC(C)O |
| InChI | InChI=1S/C35H37NO9/c1-21-9-8-12-29-33(21)28(34(40)26-13-15-27(16-14-26)42-19-25-10-6-5-7-11-25)18-36(29)32-17-30(43-23(3)38)35(44-24(4)39)31(45-32)20-41-22(2)37/h5-16,18,22,30-32,35,37H,17,19-20H2,1-4H3/t22?,30-,31-,32-,35+/m1/s1 |
| InChIKey | HSVGCZOQPWWBLB-QTSWSJMHSA-N |
| XLogP | 5.27 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.68 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|