C20H25IN6O — CID 177194785
4-[4-(iodomethyl)phenyl]-9-[6-(methylamino)pyrimidin-4-yl]-1,4,9-triazaspiro[5.5]undecan-2-one (PubChem CID 177194785) has the molecular formula C20H25IN6O and a molecular weight of 492.37 g/mol. Its IUPAC name is 4-[4-(iodomethyl)phenyl]-9-[6-(methylamino)pyrimidin-4-yl]-1,4,9-triazaspiro[5.5]undecan-2-one.
| Compound Name | 4-[4-(iodomethyl)phenyl]-9-[6-(methylamino)pyrimidin-4-yl]-1,4,9-triazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 177194785 |
| Molecular Formula | C20H25IN6O |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 4-[4-(iodomethyl)phenyl]-9-[6-(methylamino)pyrimidin-4-yl]-1,4,9-triazaspiro[5.5]undecan-2-one |
| SMILES | CNc1cc(N2CCC3(CC2)CN(c2ccc(CI)cc2)CC(=O)N3)ncn1 |
| InChI | InChI=1S/C20H25IN6O/c1-22-17-10-18(24-14-23-17)26-8-6-20(7-9-26)13-27(12-19(28)25-20)16-4-2-15(11-21)3-5-16/h2-5,10,14H,6-9,11-13H2,1H3,(H,25,28)(H,22,23,24) |
| InChIKey | YAJVWLXQOKREGU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|