C19H21N7O — CID 133489692
1-methyl-4-[6-[(4-pyrazol-1-ylphenyl)methylamino]pyrimidin-4-yl]piperazin-2-one (PubChem CID 133489692) has the molecular formula C19H21N7O and a molecular weight of 363.43 g/mol. Its IUPAC name is 1-methyl-4-[6-[(4-pyrazol-1-ylphenyl)methylamino]pyrimidin-4-yl]piperazin-2-one.
| Compound Name | 1-methyl-4-[6-[(4-pyrazol-1-ylphenyl)methylamino]pyrimidin-4-yl]piperazin-2-one |
|---|---|
| PubChem CID | 133489692 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-methyl-4-[6-[(4-pyrazol-1-ylphenyl)methylamino]pyrimidin-4-yl]piperazin-2-one |
| SMILES | CN1CCN(c2cc(NCc3ccc(-n4cccn4)cc3)ncn2)CC1=O |
| InChI | InChI=1S/C19H21N7O/c1-24-9-10-25(13-19(24)27)18-11-17(21-14-22-18)20-12-15-3-5-16(6-4-15)26-8-2-7-23-26/h2-8,11,14H,9-10,12-13H2,1H3,(H,20,21,22) |
| InChIKey | LZWQZLSICAKSFM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |