C22H35ClN4O — CID 166132583
4-[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]-1,4,9-triazaspiro[5.5]undecan-2-one;hydrochloride (PubChem CID 166132583) has the molecular formula C22H35ClN4O and a molecular weight of 407.00 g/mol. Its IUPAC name is 4-[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]-1,4,9-triazaspiro[5.5]undecan-2-one;hydrochloride.
| Compound Name | 4-[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]-1,4,9-triazaspiro[5.5]undecan-2-one;hydrochloride |
|---|---|
| PubChem CID | 166132583 |
| Molecular Formula | C22H35ClN4O |
| Molecular Weight | 407.00 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 4-[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]-1,4,9-triazaspiro[5.5]undecan-2-one;hydrochloride |
| SMILES | CC1(C)CCN(Cc2ccc(N3CC(=O)NC4(CCNCC4)C3)cc2)CC1.Cl |
| InChI | InChI=1S/C22H34N4O.ClH/c1-21(2)9-13-25(14-10-21)15-18-3-5-19(6-4-18)26-16-20(27)24-22(17-26)7-11-23-12-8-22;/h3-6,23H,7-17H2,1-2H3,(H,24,27);1H |
| InChIKey | NLGLDAKZJWPMSK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.00 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|