C16H22N4O2 — CID 117487291
1-methyl-4-[4-(piperazin-1-ylmethyl)phenyl]piperazine-2,5-dione (PubChem CID 117487291) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-methyl-4-[4-(piperazin-1-ylmethyl)phenyl]piperazine-2,5-dione.
| Compound Name | 1-methyl-4-[4-(piperazin-1-ylmethyl)phenyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 117487291 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-methyl-4-[4-(piperazin-1-ylmethyl)phenyl]piperazine-2,5-dione |
| SMILES | CN1CC(=O)N(c2ccc(CN3CCNCC3)cc2)CC1=O |
| InChI | InChI=1S/C16H22N4O2/c1-18-11-16(22)20(12-15(18)21)14-4-2-13(3-5-14)10-19-8-6-17-7-9-19/h2-5,17H,6-12H2,1H3 |
| InChIKey | KMEBFHCAQXMUKA-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |