C18H22N7O8P — CID 177194994
3-[2-cyanoethoxy-[1-[[5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methyl]triazol-4-yl]phosphoryl]oxypropanenitrile (PubChem CID 177194994) has the molecular formula C18H22N7O8P and a molecular weight of 495.39 g/mol. Its IUPAC name is 3-[2-cyanoethoxy-[1-[[5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methyl]triazol-4-yl]phosphoryl]oxypropanenitrile.
| Compound Name | 3-[2-cyanoethoxy-[1-[[5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methyl]triazol-4-yl]phosphoryl]oxypropanenitrile |
|---|---|
| PubChem CID | 177194994 |
| Molecular Formula | C18H22N7O8P |
| Molecular Weight | 495.39 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 3-[2-cyanoethoxy-[1-[[5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methyl]triazol-4-yl]phosphoryl]oxypropanenitrile |
| SMILES | COC1C(O)C(Cn2cc(P(=O)(OCCC#N)OCCC#N)nn2)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C18H22N7O8P/c1-30-16-15(27)12(33-17(16)25-7-4-13(26)21-18(25)28)10-24-11-14(22-23-24)34(29,31-8-2-5-19)32-9-3-6-20/h4,7,11-12,15-17,27H,2-3,8-10H2,1H3,(H,21,26,28) |
| InChIKey | MRWBXEHWACOJKF-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 207.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.39 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|