C17H13ClN4O4S — CID 177198430
3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea (PubChem CID 177198430) has the molecular formula C17H13ClN4O4S and a molecular weight of 404.84 g/mol. Its IUPAC name is 3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea.
| Compound Name | 3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea |
|---|---|
| PubChem CID | 177198430 |
| Molecular Formula | C17H13ClN4O4S |
| Molecular Weight | 404.84 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea |
| SMILES | CN(C(=O)Nc1ncc(Oc2cccc(Cl)c2)s1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13ClN4O4S/c1-21(12-5-3-6-13(9-12)22(24)25)17(23)20-16-19-10-15(27-16)26-14-7-2-4-11(18)8-14/h2-10H,1H3,(H,19,20,23) |
| InChIKey | RFJHZVHEPRQPIP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.84 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|