About 3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea
3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea (PubChem CID 177198430) has the molecular formula C17H13ClN4O4S
and a molecular weight of 404.84 g/mol. Its IUPAC name is 3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea.
Molecular Properties
| Compound Name | 3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea |
| PubChem CID | 177198430 |
| Molecular Formula | C17H13ClN4O4S |
| Molecular Weight | 404.84 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea |
| SMILES | CN(C(=O)Nc1ncc(Oc2cccc(Cl)c2)s1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13ClN4O4S/c1-21(12-5-3-6-13(9-12)22(24)25)17(23)20-16-19-10-15(27-16)26-14-7-2-4-11(18)8-14/h2-10H,1H3,(H,19,20,23) |
| InChIKey | RFJHZVHEPRQPIP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.84 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea?
The IUPAC name of 3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea (CID 177198430) is 3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea.
What is the SMILES notation for 3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea?
The canonical SMILES for 3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea is CN(C(=O)Nc1ncc(Oc2cccc(Cl)c2)s1)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea?
The InChIKey is RFJHZVHEPRQPIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN4O4S/c1-21(12-5-3-6-13(9-12)22(24)25)17(23)20-16-19-10-15(27-16)26-14-7-2-4-11(18)8-14/h2-10H,1H3,(H,19,20,23).
What are the key properties of 3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea?
3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea has a molecular weight of 404.84 g/mol, XLogP of 5.17, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(3-chlorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(3-nitrophenyl)urea is sourced from PubChem (CID 177198430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).