C10H7N3O5S — CID 87714368
[5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid (PubChem CID 87714368) has the molecular formula C10H7N3O5S and a molecular weight of 281.25 g/mol. Its IUPAC name is [5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid.
| Compound Name | [5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87714368 |
| Molecular Formula | C10H7N3O5S |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | [5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid |
| SMILES | O=C(O)Nc1ncc(Oc2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C10H7N3O5S/c14-10(15)12-9-11-5-8(19-9)18-7-3-1-6(2-4-7)13(16)17/h1-5H,(H,11,12)(H,14,15) |
| InChIKey | AIEPBZFBROAVMJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|