[5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid

C10H7N3O5S — CID 87714368

IUPAC[5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid
SMILESO=C(O)Nc1ncc(Oc2ccc([N+](=O)[O-])cc2)s1
InChIInChI=1S/C10H7N3O5S/c14-10(15)12-9-11-5-8(19-9)18-7-3-1-6(2-4-7)13(16)17/h1-5H,(H,11,12)(H,14,15)
InChIKeyAIEPBZFBROAVMJ-UHFFFAOYSA-N
MW281.25 g/mol
LogP2.93
Rot. Bonds4

About [5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid

[5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid (PubChem CID 87714368) has the molecular formula C10H7N3O5S and a molecular weight of 281.25 g/mol. Its IUPAC name is [5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid.

Molecular Properties

Compound Name[5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid
PubChem CID87714368
Molecular FormulaC10H7N3O5S
Molecular Weight281.25 g/mol
Exact Mass281.01
IUPAC Name[5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid
SMILESO=C(O)Nc1ncc(Oc2ccc([N+](=O)[O-])cc2)s1
InChIInChI=1S/C10H7N3O5S/c14-10(15)12-9-11-5-8(19-9)18-7-3-1-6(2-4-7)13(16)17/h1-5H,(H,11,12)(H,14,15)
InChIKeyAIEPBZFBROAVMJ-UHFFFAOYSA-N
XLogP2.93
TPSA114.59 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.25
LogP ≤ 52.93
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid?
The IUPAC name of [5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid (CID 87714368) is [5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid.
What is the SMILES notation for [5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid?
The canonical SMILES for [5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid is O=C(O)Nc1ncc(Oc2ccc([N+](=O)[O-])cc2)s1.
What is the InChIKey of [5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid?
The InChIKey is AIEPBZFBROAVMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O5S/c14-10(15)12-9-11-5-8(19-9)18-7-3-1-6(2-4-7)13(16)17/h1-5H,(H,11,12)(H,14,15).
What are the key properties of [5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid?
[5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid has a molecular weight of 281.25 g/mol, XLogP of 2.93, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-nitrophenoxy)-1,3-thiazol-2-yl]carbamic acid is sourced from PubChem (CID 87714368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).