C14H8BrN3O5S — CID 87824563
[4-bromo-6-(4-nitrophenoxy)-1,3-benzothiazol-2-yl]carbamic acid (PubChem CID 87824563) has the molecular formula C14H8BrN3O5S and a molecular weight of 410.21 g/mol. Its IUPAC name is [4-bromo-6-(4-nitrophenoxy)-1,3-benzothiazol-2-yl]carbamic acid.
| Compound Name | [4-bromo-6-(4-nitrophenoxy)-1,3-benzothiazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87824563 |
| Molecular Formula | C14H8BrN3O5S |
| Molecular Weight | 410.21 g/mol |
| Exact Mass | 408.94 |
| IUPAC Name | [4-bromo-6-(4-nitrophenoxy)-1,3-benzothiazol-2-yl]carbamic acid |
| SMILES | O=C(O)Nc1nc2c(Br)cc(Oc3ccc([N+](=O)[O-])cc3)cc2s1 |
| InChI | InChI=1S/C14H8BrN3O5S/c15-10-5-9(23-8-3-1-7(2-4-8)18(21)22)6-11-12(10)16-13(24-11)17-14(19)20/h1-6H,(H,16,17)(H,19,20) |
| InChIKey | IRIKUYXHYNBCGW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.21 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|