C20H21FN4OS — CID 177198527
1-[4-(dimethylamino)phenyl]-3-[5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]-1-methylurea (PubChem CID 177198527) has the molecular formula C20H21FN4OS and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-[5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]-1-methylurea.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-[5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]-1-methylurea |
|---|---|
| PubChem CID | 177198527 |
| Molecular Formula | C20H21FN4OS |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-[5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]-1-methylurea |
| SMILES | CN(C)c1ccc(N(C)C(=O)Nc2ncc(Cc3cccc(F)c3)s2)cc1 |
| InChI | InChI=1S/C20H21FN4OS/c1-24(2)16-7-9-17(10-8-16)25(3)20(26)23-19-22-13-18(27-19)12-14-5-4-6-15(21)11-14/h4-11,13H,12H2,1-3H3,(H,22,23,26) |
| InChIKey | VRIGXEXPDIFSFN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|