C8H4ClF4NO2 — CID 177201389
(1Z)-5-fluoro-N,2-dihydroxy-3-(trifluoromethyl)benzenecarboximidoyl chloride (PubChem CID 177201389) has the molecular formula C8H4ClF4NO2 and a molecular weight of 257.57 g/mol. Its IUPAC name is (1Z)-5-fluoro-N,2-dihydroxy-3-(trifluoromethyl)benzenecarboximidoyl chloride.
| Compound Name | (1Z)-5-fluoro-N,2-dihydroxy-3-(trifluoromethyl)benzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 177201389 |
| Molecular Formula | C8H4ClF4NO2 |
| Molecular Weight | 257.57 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | (1Z)-5-fluoro-N,2-dihydroxy-3-(trifluoromethyl)benzenecarboximidoyl chloride |
| SMILES | O/N=C(\Cl)c1cc(F)cc(C(F)(F)F)c1O |
| InChI | InChI=1S/C8H4ClF4NO2/c9-7(14-16)4-1-3(10)2-5(6(4)15)8(11,12)13/h1-2,15-16H/b14-7- |
| InChIKey | XFUCDXVVRUJYCO-AUWJEWJLSA-N |
| XLogP | 2.92 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|