C14H16N4OS — CID 177202634
5-[3-(azetidin-1-yl)pyrrolidin-1-yl]-[1,3]thiazolo[5,4-b]pyridine-2-carbaldehyde (PubChem CID 177202634) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is 5-[3-(azetidin-1-yl)pyrrolidin-1-yl]-[1,3]thiazolo[5,4-b]pyridine-2-carbaldehyde.
| Compound Name | 5-[3-(azetidin-1-yl)pyrrolidin-1-yl]-[1,3]thiazolo[5,4-b]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 177202634 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 5-[3-(azetidin-1-yl)pyrrolidin-1-yl]-[1,3]thiazolo[5,4-b]pyridine-2-carbaldehyde |
| SMILES | O=Cc1nc2ccc(N3CCC(N4CCC4)C3)nc2s1 |
| InChI | InChI=1S/C14H16N4OS/c19-9-13-15-11-2-3-12(16-14(11)20-13)18-7-4-10(8-18)17-5-1-6-17/h2-3,9-10H,1,4-8H2 |
| InChIKey | HCAYIPPQGIJXBN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|