C22H20F3N5O2 — CID 177203056
benzyl 3-(trifluoromethyl)spiro[2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,4'-piperidine]-1'-carboxylate (PubChem CID 177203056) has the molecular formula C22H20F3N5O2 and a molecular weight of 443.43 g/mol. Its IUPAC name is benzyl 3-(trifluoromethyl)spiro[2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,4'-piperidine]-1'-carboxylate.
| Compound Name | benzyl 3-(trifluoromethyl)spiro[2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 177203056 |
| Molecular Formula | C22H20F3N5O2 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | benzyl 3-(trifluoromethyl)spiro[2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,4'-piperidine]-1'-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC2(CC1)Nc1cccnc1-n1c2cnc1C(F)(F)F |
| InChI | InChI=1S/C22H20F3N5O2/c23-22(24,25)19-27-13-17-21(28-16-7-4-10-26-18(16)30(17)19)8-11-29(12-9-21)20(31)32-14-15-5-2-1-3-6-15/h1-7,10,13,28H,8-9,11-12,14H2 |
| InChIKey | DPRRBOFDRMIUAQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |