C17H22BrNO4 — CID 177204980
tert-butyl (2R,4aS,10bS)-8-bromo-2-methyl-3,4a,5,10b-tetrahydro-2H-chromeno[3,4-b][1,4]oxazine-1-carboxylate (PubChem CID 177204980) has the molecular formula C17H22BrNO4 and a molecular weight of 384.27 g/mol. Its IUPAC name is tert-butyl (2R,4aS,10bS)-8-bromo-2-methyl-3,4a,5,10b-tetrahydro-2H-chromeno[3,4-b][1,4]oxazine-1-carboxylate.
| Compound Name | tert-butyl (2R,4aS,10bS)-8-bromo-2-methyl-3,4a,5,10b-tetrahydro-2H-chromeno[3,4-b][1,4]oxazine-1-carboxylate |
|---|---|
| PubChem CID | 177204980 |
| Molecular Formula | C17H22BrNO4 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | tert-butyl (2R,4aS,10bS)-8-bromo-2-methyl-3,4a,5,10b-tetrahydro-2H-chromeno[3,4-b][1,4]oxazine-1-carboxylate |
| SMILES | C[C@@H]1CO[C@@H]2COc3cc(Br)ccc3[C@@H]2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H22BrNO4/c1-10-8-21-14-9-22-13-7-11(18)5-6-12(13)15(14)19(10)16(20)23-17(2,3)4/h5-7,10,14-15H,8-9H2,1-4H3/t10-,14-,15+/m1/s1 |
| InChIKey | DRGBERJAVPOSIY-KMUNFCNLSA-N |
| XLogP | 3.91 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |