C18H23F2NO4 — CID 177205356
tert-butyl (3R,4aR,9aS)-7-(difluoromethoxy)-3-methyl-3,4a,9,9a-tetrahydro-2H-indeno[2,1-b][1,4]oxazine-4-carboxylate (PubChem CID 177205356) has the molecular formula C18H23F2NO4 and a molecular weight of 355.38 g/mol. Its IUPAC name is tert-butyl (3R,4aR,9aS)-7-(difluoromethoxy)-3-methyl-3,4a,9,9a-tetrahydro-2H-indeno[2,1-b][1,4]oxazine-4-carboxylate.
| Compound Name | tert-butyl (3R,4aR,9aS)-7-(difluoromethoxy)-3-methyl-3,4a,9,9a-tetrahydro-2H-indeno[2,1-b][1,4]oxazine-4-carboxylate |
|---|---|
| PubChem CID | 177205356 |
| Molecular Formula | C18H23F2NO4 |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | tert-butyl (3R,4aR,9aS)-7-(difluoromethoxy)-3-methyl-3,4a,9,9a-tetrahydro-2H-indeno[2,1-b][1,4]oxazine-4-carboxylate |
| SMILES | C[C@@H]1CO[C@H]2Cc3cc(OC(F)F)ccc3[C@H]2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23F2NO4/c1-10-9-23-14-8-11-7-12(24-16(19)20)5-6-13(11)15(14)21(10)17(22)25-18(2,3)4/h5-7,10,14-16H,8-9H2,1-4H3/t10-,14+,15-/m1/s1 |
| InChIKey | MQLPZRQOCSWLGS-WKPIXPDZSA-N |
| XLogP | 3.91 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |