C20H31N3S — CID 177204990
4-[5-[(2R,5S)-1,5-dimethylpiperidin-2-yl]-1,3-benzothiazol-2-yl]-N,N-dimethylbutan-1-amine (PubChem CID 177204990) has the molecular formula C20H31N3S and a molecular weight of 345.56 g/mol. Its IUPAC name is 4-[5-[(2R,5S)-1,5-dimethylpiperidin-2-yl]-1,3-benzothiazol-2-yl]-N,N-dimethylbutan-1-amine.
| Compound Name | 4-[5-[(2R,5S)-1,5-dimethylpiperidin-2-yl]-1,3-benzothiazol-2-yl]-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 177204990 |
| Molecular Formula | C20H31N3S |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 4-[5-[(2R,5S)-1,5-dimethylpiperidin-2-yl]-1,3-benzothiazol-2-yl]-N,N-dimethylbutan-1-amine |
| SMILES | C[C@H]1CC[C@H](c2ccc3sc(CCCCN(C)C)nc3c2)N(C)C1 |
| InChI | InChI=1S/C20H31N3S/c1-15-8-10-18(23(4)14-15)16-9-11-19-17(13-16)21-20(24-19)7-5-6-12-22(2)3/h9,11,13,15,18H,5-8,10,12,14H2,1-4H3/t15-,18+/m0/s1 |
| InChIKey | ROGGOOXWIZKMHP-MAUKXSAKSA-N |
| XLogP | 4.58 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|