C11H16F2INO4 — CID 177206838
1-O-tert-butyl 2-O-methyl (5S)-4,4-difluoro-5-iodopyrrolidine-1,2-dicarboxylate (PubChem CID 177206838) has the molecular formula C11H16F2INO4 and a molecular weight of 391.15 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (5S)-4,4-difluoro-5-iodopyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (5S)-4,4-difluoro-5-iodopyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 177206838 |
| Molecular Formula | C11H16F2INO4 |
| Molecular Weight | 391.15 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (5S)-4,4-difluoro-5-iodopyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)C1CC(F)(F)[C@H](I)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H16F2INO4/c1-10(2,3)19-9(17)15-6(7(16)18-4)5-11(12,13)8(15)14/h6,8H,5H2,1-4H3/t6?,8-/m1/s1 |
| InChIKey | SLYDHBXPZCUWMX-QFSRMBNQSA-N |
| XLogP | 2.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.15 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|