C17H22F3N2O3Si — CID 177207068
CID 177207068 (PubChem CID 177207068) has the molecular formula C17H22F3N2O3Si and a molecular weight of 387.45 g/mol.
| Compound Name | CID 177207068 |
|---|---|
| PubChem CID | 177207068 |
| Molecular Formula | C17H22F3N2O3Si |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | — |
| SMILES | CC1(C)C[C@@H]2Oc3nc(C(F)(F)F)ccc3[Si]2N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H22F3N2O3Si/c1-15(2,3)25-14(23)22-9-16(4,5)8-12-24-13-10(26(12)22)6-7-11(21-13)17(18,19)20/h6-7,12H,8-9H2,1-5H3/t12-/m1/s1 |
| InChIKey | KKWQJDZJRADIFF-GFCCVEGCSA-N |
| XLogP | 3.27 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|