C17H22F3N3O2S — CID 169160869
tert-butyl 2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]sulfanyl]-2,6-diazaspiro[3.3]heptane-6-carboxylate (PubChem CID 169160869) has the molecular formula C17H22F3N3O2S and a molecular weight of 389.44 g/mol. Its IUPAC name is tert-butyl 2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]sulfanyl]-2,6-diazaspiro[3.3]heptane-6-carboxylate.
| Compound Name | tert-butyl 2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]sulfanyl]-2,6-diazaspiro[3.3]heptane-6-carboxylate |
|---|---|
| PubChem CID | 169160869 |
| Molecular Formula | C17H22F3N3O2S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | tert-butyl 2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]sulfanyl]-2,6-diazaspiro[3.3]heptane-6-carboxylate |
| SMILES | Cc1nc(C(F)(F)F)ccc1SN1CC2(C1)CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C17H22F3N3O2S/c1-11-12(5-6-13(21-11)17(18,19)20)26-23-9-16(10-23)7-22(8-16)14(24)25-15(2,3)4/h5-6H,7-10H2,1-4H3 |
| InChIKey | BQKLWMWSBUBXKH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|