C16H22ClN3O2S — CID 176919888
tert-butyl 2-[(6-chloro-2-methyl-3-pyridinyl)sulfanyl]-2,6-diazaspiro[3.3]heptane-6-carboxylate (PubChem CID 176919888) has the molecular formula C16H22ClN3O2S and a molecular weight of 355.89 g/mol. Its IUPAC name is tert-butyl 2-[(6-chloro-2-methyl-3-pyridinyl)sulfanyl]-2,6-diazaspiro[3.3]heptane-6-carboxylate.
| Compound Name | tert-butyl 2-[(6-chloro-2-methyl-3-pyridinyl)sulfanyl]-2,6-diazaspiro[3.3]heptane-6-carboxylate |
|---|---|
| PubChem CID | 176919888 |
| Molecular Formula | C16H22ClN3O2S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | tert-butyl 2-[(6-chloro-2-methyl-3-pyridinyl)sulfanyl]-2,6-diazaspiro[3.3]heptane-6-carboxylate |
| SMILES | Cc1nc(Cl)ccc1SN1CC2(C1)CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C16H22ClN3O2S/c1-11-12(5-6-13(17)18-11)23-20-9-16(10-20)7-19(8-16)14(21)22-15(2,3)4/h5-6H,7-10H2,1-4H3 |
| InChIKey | PEXBYQBJBUKZTM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|