C17H21Br2ClN2O2 — CID 177196718
tert-butyl 6-bromo-6-[bromo-(6-chloro-3-pyridinyl)methyl]-2-azaspiro[3.3]heptane-2-carboxylate (PubChem CID 177196718) has the molecular formula C17H21Br2ClN2O2 and a molecular weight of 480.63 g/mol. Its IUPAC name is tert-butyl 6-bromo-6-[bromo-(6-chloro-3-pyridinyl)methyl]-2-azaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-bromo-6-[bromo-(6-chloro-3-pyridinyl)methyl]-2-azaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 177196718 |
| Molecular Formula | C17H21Br2ClN2O2 |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 477.97 |
| IUPAC Name | tert-butyl 6-bromo-6-[bromo-(6-chloro-3-pyridinyl)methyl]-2-azaspiro[3.3]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(Br)(C(Br)c1ccc(Cl)nc1)C2 |
| InChI | InChI=1S/C17H21Br2ClN2O2/c1-15(2,3)24-14(23)22-9-16(10-22)7-17(19,8-16)13(18)11-4-5-12(20)21-6-11/h4-6,13H,7-10H2,1-3H3 |
| InChIKey | IKAYXPRFPVUHPC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|