C19H26Cl2N2O3 — CID 138977380
tert-butyl 4-[(2R,3R)-2-(chloromethyl)-3-(6-chloro-3-pyridinyl)-3-hydroxypropylidene]piperidine-1-carboxylate (PubChem CID 138977380) has the molecular formula C19H26Cl2N2O3 and a molecular weight of 401.33 g/mol. Its IUPAC name is tert-butyl 4-[(2R,3R)-2-(chloromethyl)-3-(6-chloro-3-pyridinyl)-3-hydroxypropylidene]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2R,3R)-2-(chloromethyl)-3-(6-chloro-3-pyridinyl)-3-hydroxypropylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 138977380 |
| Molecular Formula | C19H26Cl2N2O3 |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | tert-butyl 4-[(2R,3R)-2-(chloromethyl)-3-(6-chloro-3-pyridinyl)-3-hydroxypropylidene]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=C[C@@H](CCl)[C@@H](O)c2ccc(Cl)nc2)CC1 |
| InChI | InChI=1S/C19H26Cl2N2O3/c1-19(2,3)26-18(25)23-8-6-13(7-9-23)10-15(11-20)17(24)14-4-5-16(21)22-12-14/h4-5,10,12,15,17,24H,6-9,11H2,1-3H3/t15-,17-/m0/s1 |
| InChIKey | WYVMYUQNSMNYSV-RDJZCZTQSA-N |
| XLogP | 4.58 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|