C18H27N3O — CID 177208147
2-[6-(methylamino)-2-propan-2-yl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]propanal (PubChem CID 177208147) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-[6-(methylamino)-2-propan-2-yl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]propanal.
| Compound Name | 2-[6-(methylamino)-2-propan-2-yl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]propanal |
|---|---|
| PubChem CID | 177208147 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 2-[6-(methylamino)-2-propan-2-yl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]propanal |
| SMILES | CNc1cccc2c1N(C(C)C=O)C1CCN(C(C)C)CC21 |
| InChI | InChI=1S/C18H27N3O/c1-12(2)20-9-8-17-15(10-20)14-6-5-7-16(19-4)18(14)21(17)13(3)11-22/h5-7,11-13,15,17,19H,8-10H2,1-4H3 |
| InChIKey | IEEKOQHNOIGHQJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|