C24H30FN3O — CID 155443407
2-[2-[4-(4-fluorophenyl)butyl]-6-(methylamino)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]acetaldehyde (PubChem CID 155443407) has the molecular formula C24H30FN3O and a molecular weight of 395.52 g/mol. Its IUPAC name is 2-[2-[4-(4-fluorophenyl)butyl]-6-(methylamino)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]acetaldehyde.
| Compound Name | 2-[2-[4-(4-fluorophenyl)butyl]-6-(methylamino)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 155443407 |
| Molecular Formula | C24H30FN3O |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 2-[2-[4-(4-fluorophenyl)butyl]-6-(methylamino)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]acetaldehyde |
| SMILES | CNc1cccc2c1N(CC=O)C1CCN(CCCCc3ccc(F)cc3)CC21 |
| InChI | InChI=1S/C24H30FN3O/c1-26-22-7-4-6-20-21-17-27(14-12-23(21)28(15-16-29)24(20)22)13-3-2-5-18-8-10-19(25)11-9-18/h4,6-11,16,21,23,26H,2-3,5,12-15,17H2,1H3 |
| InChIKey | WSIQSQSKCAKIJD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|