C21H25ClN4O4S — CID 177210954
2-chloro-N-methyl-5-[[1-methylsulfonyl-3-(2-propan-2-ylphenyl)azetidine-3-carbonyl]amino]pyridine-4-carboxamide (PubChem CID 177210954) has the molecular formula C21H25ClN4O4S and a molecular weight of 464.98 g/mol. Its IUPAC name is 2-chloro-N-methyl-5-[[1-methylsulfonyl-3-(2-propan-2-ylphenyl)azetidine-3-carbonyl]amino]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-methyl-5-[[1-methylsulfonyl-3-(2-propan-2-ylphenyl)azetidine-3-carbonyl]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 177210954 |
| Molecular Formula | C21H25ClN4O4S |
| Molecular Weight | 464.98 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-chloro-N-methyl-5-[[1-methylsulfonyl-3-(2-propan-2-ylphenyl)azetidine-3-carbonyl]amino]pyridine-4-carboxamide |
| SMILES | CNC(=O)c1cc(Cl)ncc1NC(=O)C1(c2ccccc2C(C)C)CN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C21H25ClN4O4S/c1-13(2)14-7-5-6-8-16(14)21(11-26(12-21)31(4,29)30)20(28)25-17-10-24-18(22)9-15(17)19(27)23-3/h5-10,13H,11-12H2,1-4H3,(H,23,27)(H,25,28) |
| InChIKey | IVGVSZPBUKCKPM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.98 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|