C21H24ClN5O2S — CID 177211099
5-[[1-carbamothioyl-3-(2-propan-2-ylphenyl)azetidine-3-carbonyl]amino]-2-chloro-N-methylpyridine-4-carboxamide (PubChem CID 177211099) has the molecular formula C21H24ClN5O2S and a molecular weight of 445.98 g/mol. Its IUPAC name is 5-[[1-carbamothioyl-3-(2-propan-2-ylphenyl)azetidine-3-carbonyl]amino]-2-chloro-N-methylpyridine-4-carboxamide.
| Compound Name | 5-[[1-carbamothioyl-3-(2-propan-2-ylphenyl)azetidine-3-carbonyl]amino]-2-chloro-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 177211099 |
| Molecular Formula | C21H24ClN5O2S |
| Molecular Weight | 445.98 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 5-[[1-carbamothioyl-3-(2-propan-2-ylphenyl)azetidine-3-carbonyl]amino]-2-chloro-N-methylpyridine-4-carboxamide |
| SMILES | CNC(=O)c1cc(Cl)ncc1NC(=O)C1(c2ccccc2C(C)C)CN(C(N)=S)C1 |
| InChI | InChI=1S/C21H24ClN5O2S/c1-12(2)13-6-4-5-7-15(13)21(10-27(11-21)20(23)30)19(29)26-16-9-25-17(22)8-14(16)18(28)24-3/h4-9,12H,10-11H2,1-3H3,(H2,23,30)(H,24,28)(H,26,29) |
| InChIKey | BNICMKXFGSOWFS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.98 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|