C24H29ClN4O4 — CID 177211084
methyl 4-[[6-chloro-4-(methylcarbamoyl)-3-pyridinyl]carbamoyl]-4-(2-propan-2-ylphenyl)piperidine-1-carboxylate (PubChem CID 177211084) has the molecular formula C24H29ClN4O4 and a molecular weight of 472.97 g/mol. Its IUPAC name is methyl 4-[[6-chloro-4-(methylcarbamoyl)-3-pyridinyl]carbamoyl]-4-(2-propan-2-ylphenyl)piperidine-1-carboxylate.
| Compound Name | methyl 4-[[6-chloro-4-(methylcarbamoyl)-3-pyridinyl]carbamoyl]-4-(2-propan-2-ylphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177211084 |
| Molecular Formula | C24H29ClN4O4 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | methyl 4-[[6-chloro-4-(methylcarbamoyl)-3-pyridinyl]carbamoyl]-4-(2-propan-2-ylphenyl)piperidine-1-carboxylate |
| SMILES | CNC(=O)c1cc(Cl)ncc1NC(=O)C1(c2ccccc2C(C)C)CCN(C(=O)OC)CC1 |
| InChI | InChI=1S/C24H29ClN4O4/c1-15(2)16-7-5-6-8-18(16)24(9-11-29(12-10-24)23(32)33-4)22(31)28-19-14-27-20(25)13-17(19)21(30)26-3/h5-8,13-15H,9-12H2,1-4H3,(H,26,30)(H,28,31) |
| InChIKey | ZBJGXOYAXNPKRO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|