C28H31ClFN4O3P — CID 177211200
2-chloro-5-[[1-(4-dimethylphosphoryl-3-fluorophenyl)-3-(2-propan-2-ylphenyl)azetidine-3-carbonyl]amino]-N-methylpyridine-4-carboxamide (PubChem CID 177211200) has the molecular formula C28H31ClFN4O3P and a molecular weight of 557.01 g/mol. Its IUPAC name is 2-chloro-5-[[1-(4-dimethylphosphoryl-3-fluorophenyl)-3-(2-propan-2-ylphenyl)azetidine-3-carbonyl]amino]-N-methylpyridine-4-carboxamide.
| Compound Name | 2-chloro-5-[[1-(4-dimethylphosphoryl-3-fluorophenyl)-3-(2-propan-2-ylphenyl)azetidine-3-carbonyl]amino]-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 177211200 |
| Molecular Formula | C28H31ClFN4O3P |
| Molecular Weight | 557.01 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 2-chloro-5-[[1-(4-dimethylphosphoryl-3-fluorophenyl)-3-(2-propan-2-ylphenyl)azetidine-3-carbonyl]amino]-N-methylpyridine-4-carboxamide |
| SMILES | CNC(=O)c1cc(Cl)ncc1NC(=O)C1(c2ccccc2C(C)C)CN(c2ccc(P(C)(C)=O)c(F)c2)C1 |
| InChI | InChI=1S/C28H31ClFN4O3P/c1-17(2)19-8-6-7-9-21(19)28(27(36)33-23-14-32-25(29)13-20(23)26(35)31-3)15-34(16-28)18-10-11-24(22(30)12-18)38(4,5)37/h6-14,17H,15-16H2,1-5H3,(H,31,35)(H,33,36) |
| InChIKey | UYFIBYHRMIUVKC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.01 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|