C19H25ClN2O3 — CID 177211599
tert-butyl N-[[3-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]cyclobutyl]methyl]carbamate (PubChem CID 177211599) has the molecular formula C19H25ClN2O3 and a molecular weight of 364.87 g/mol. Its IUPAC name is tert-butyl N-[[3-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]cyclobutyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]cyclobutyl]methyl]carbamate |
|---|---|
| PubChem CID | 177211599 |
| Molecular Formula | C19H25ClN2O3 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | tert-butyl N-[[3-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]cyclobutyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CC(NC(=O)/C=C/c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H25ClN2O3/c1-19(2,3)25-18(24)21-12-14-10-16(11-14)22-17(23)9-6-13-4-7-15(20)8-5-13/h4-9,14,16H,10-12H2,1-3H3,(H,21,24)(H,22,23)/b9-6+ |
| InChIKey | SUKQCKNONNFUCH-RMKNXTFCSA-N |
| XLogP | 3.77 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|