C14H17ClN2O — CID 80562970
(E)-3-(4-chlorophenyl)-N-(pyrrolidin-3-ylmethyl)prop-2-enamide (PubChem CID 80562970) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-(pyrrolidin-3-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-(pyrrolidin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 80562970 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-(pyrrolidin-3-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NCC1CCNC1 |
| InChI | InChI=1S/C14H17ClN2O/c15-13-4-1-11(2-5-13)3-6-14(18)17-10-12-7-8-16-9-12/h1-6,12,16H,7-10H2,(H,17,18)/b6-3+ |
| InChIKey | MNESXZMIMWKDBT-ZZXKWVIFSA-N |
| XLogP | 2.08 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|