C30H48N6 — CID 177212346
(3Z)-1-cyclohexyl-N-(2-ethylbutyl)-3-[(methylideneamino)methylidene]-4-[4-(piperazin-1-ylmethyl)phenyl]pyrrol-2-imine;methanamine (PubChem CID 177212346) has the molecular formula C30H48N6 and a molecular weight of 492.76 g/mol. Its IUPAC name is (3Z)-1-cyclohexyl-N-(2-ethylbutyl)-3-[(methylideneamino)methylidene]-4-[4-(piperazin-1-ylmethyl)phenyl]pyrrol-2-imine;methanamine.
| Compound Name | (3Z)-1-cyclohexyl-N-(2-ethylbutyl)-3-[(methylideneamino)methylidene]-4-[4-(piperazin-1-ylmethyl)phenyl]pyrrol-2-imine;methanamine |
|---|---|
| PubChem CID | 177212346 |
| Molecular Formula | C30H48N6 |
| Molecular Weight | 492.76 g/mol |
| Exact Mass | 492.39 |
| IUPAC Name | (3Z)-1-cyclohexyl-N-(2-ethylbutyl)-3-[(methylideneamino)methylidene]-4-[4-(piperazin-1-ylmethyl)phenyl]pyrrol-2-imine;methanamine |
| SMILES | C=N/C=C1/C(c2ccc(CN3CCNCC3)cc2)=CN(C2CCCCC2)/C1=N\CC(CC)CC.CN |
| InChI | InChI=1S/C29H43N5.CH5N/c1-4-23(5-2)19-32-29-27(20-30-3)28(22-34(29)26-9-7-6-8-10-26)25-13-11-24(12-14-25)21-33-17-15-31-16-18-33;1-2/h11-14,20,22-23,26,31H,3-10,15-19,21H2,1-2H3;2H2,1H3/b27-20-,32-29-; |
| InChIKey | PXGFMPHTHMGWOO-ZMDSANPSSA-N |
| XLogP | 5.08 |
| TPSA | 69.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.76 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|