C11H18N2O5 — CID 177217825
3-[3-[(4-oxopyrrolidine-3-carbonyl)amino]propoxy]propanoic acid (PubChem CID 177217825) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is 3-[3-[(4-oxopyrrolidine-3-carbonyl)amino]propoxy]propanoic acid.
| Compound Name | 3-[3-[(4-oxopyrrolidine-3-carbonyl)amino]propoxy]propanoic acid |
|---|---|
| PubChem CID | 177217825 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 3-[3-[(4-oxopyrrolidine-3-carbonyl)amino]propoxy]propanoic acid |
| SMILES | O=C(O)CCOCCCNC(=O)C1CNCC1=O |
| InChI | InChI=1S/C11H18N2O5/c14-9-7-12-6-8(9)11(17)13-3-1-4-18-5-2-10(15)16/h8,12H,1-7H2,(H,13,17)(H,15,16) |
| InChIKey | VGUOHHUHMDVQBC-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|