C13H29N3 — CID 177223374
ethane;molecular hydrogen;(E,1Z)-1-(1-piperidin-1-ylethylimino)but-2-en-2-amine (PubChem CID 177223374) has the molecular formula C13H29N3 and a molecular weight of 227.40 g/mol. Its IUPAC name is ethane;molecular hydrogen;(E,1Z)-1-(1-piperidin-1-ylethylimino)but-2-en-2-amine.
| Compound Name | ethane;molecular hydrogen;(E,1Z)-1-(1-piperidin-1-ylethylimino)but-2-en-2-amine |
|---|---|
| PubChem CID | 177223374 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | ethane;molecular hydrogen;(E,1Z)-1-(1-piperidin-1-ylethylimino)but-2-en-2-amine |
| SMILES | C/C=C(N)\C=N/C(C)N1CCCCC1.CC.[H][H] |
| InChI | InChI=1S/C11H21N3.C2H6.H2/c1-3-11(12)9-13-10(2)14-7-5-4-6-8-14;1-2;/h3,9-10H,4-8,12H2,1-2H3;1-2H3;1H/b11-3+,13-9-;; |
| InChIKey | ZPJFAAYHMKBIME-MSEONJBQSA-N |
| XLogP | 3.02 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|