C12H9N5OS — CID 177228471
7-[(2-oxo-1,3-dihydroimidazol-4-yl)sulfanylamino]-1H-indole-3-carbonitrile (PubChem CID 177228471) has the molecular formula C12H9N5OS and a molecular weight of 271.31 g/mol. Its IUPAC name is 7-[(2-oxo-1,3-dihydroimidazol-4-yl)sulfanylamino]-1H-indole-3-carbonitrile.
| Compound Name | 7-[(2-oxo-1,3-dihydroimidazol-4-yl)sulfanylamino]-1H-indole-3-carbonitrile |
|---|---|
| PubChem CID | 177228471 |
| Molecular Formula | C12H9N5OS |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 7-[(2-oxo-1,3-dihydroimidazol-4-yl)sulfanylamino]-1H-indole-3-carbonitrile |
| SMILES | N#Cc1c[nH]c2c(NSc3c[nH]c(=O)[nH]3)cccc12 |
| InChI | InChI=1S/C12H9N5OS/c13-4-7-5-14-11-8(7)2-1-3-9(11)17-19-10-6-15-12(18)16-10/h1-3,5-6,14,17H,(H2,15,16,18) |
| InChIKey | AULAYHNXUOEUNO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|