C19H18N4OS — CID 171804927
3-[(3-cyano-4-methyl-1H-indol-7-yl)amino]sulfanyl-N,N-dimethylbenzamide (PubChem CID 171804927) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is 3-[(3-cyano-4-methyl-1H-indol-7-yl)amino]sulfanyl-N,N-dimethylbenzamide.
| Compound Name | 3-[(3-cyano-4-methyl-1H-indol-7-yl)amino]sulfanyl-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 171804927 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 3-[(3-cyano-4-methyl-1H-indol-7-yl)amino]sulfanyl-N,N-dimethylbenzamide |
| SMILES | Cc1ccc(NSc2cccc(C(=O)N(C)C)c2)c2[nH]cc(C#N)c12 |
| InChI | InChI=1S/C19H18N4OS/c1-12-7-8-16(18-17(12)14(10-20)11-21-18)22-25-15-6-4-5-13(9-15)19(24)23(2)3/h4-9,11,21-22H,1-3H3 |
| InChIKey | RGYSYJLWMJSLJT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|