C13H10N4S2 — CID 170949637
4-methyl-7-(1,2-thiazol-4-ylsulfanylamino)-1H-indole-3-carbonitrile (PubChem CID 170949637) has the molecular formula C13H10N4S2 and a molecular weight of 286.39 g/mol. Its IUPAC name is 4-methyl-7-(1,2-thiazol-4-ylsulfanylamino)-1H-indole-3-carbonitrile.
| Compound Name | 4-methyl-7-(1,2-thiazol-4-ylsulfanylamino)-1H-indole-3-carbonitrile |
|---|---|
| PubChem CID | 170949637 |
| Molecular Formula | C13H10N4S2 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 4-methyl-7-(1,2-thiazol-4-ylsulfanylamino)-1H-indole-3-carbonitrile |
| SMILES | Cc1ccc(NSc2cnsc2)c2[nH]cc(C#N)c12 |
| InChI | InChI=1S/C13H10N4S2/c1-8-2-3-11(17-19-10-6-16-18-7-10)13-12(8)9(4-14)5-15-13/h2-3,5-7,15,17H,1H3 |
| InChIKey | DIDAHDLBFHYTJO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|