C17H12N4S — CID 153329674
7-[(4-cyanophenyl)sulfanylamino]-4-methyl-1H-indole-3-carbonitrile (PubChem CID 153329674) has the molecular formula C17H12N4S and a molecular weight of 304.38 g/mol. Its IUPAC name is 7-[(4-cyanophenyl)sulfanylamino]-4-methyl-1H-indole-3-carbonitrile.
| Compound Name | 7-[(4-cyanophenyl)sulfanylamino]-4-methyl-1H-indole-3-carbonitrile |
|---|---|
| PubChem CID | 153329674 |
| Molecular Formula | C17H12N4S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 7-[(4-cyanophenyl)sulfanylamino]-4-methyl-1H-indole-3-carbonitrile |
| SMILES | Cc1ccc(NSc2ccc(C#N)cc2)c2[nH]cc(C#N)c12 |
| InChI | InChI=1S/C17H12N4S/c1-11-2-7-15(17-16(11)13(9-19)10-20-17)21-22-14-5-3-12(8-18)4-6-14/h2-7,10,20-21H,1H3 |
| InChIKey | ORALHTQKUKDYKF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|