C16H17N5S — CID 170949765
7-[(1-ethyl-2-methylimidazol-4-yl)sulfanylamino]-4-methyl-1H-indole-3-carbonitrile (PubChem CID 170949765) has the molecular formula C16H17N5S and a molecular weight of 311.41 g/mol. Its IUPAC name is 7-[(1-ethyl-2-methylimidazol-4-yl)sulfanylamino]-4-methyl-1H-indole-3-carbonitrile.
| Compound Name | 7-[(1-ethyl-2-methylimidazol-4-yl)sulfanylamino]-4-methyl-1H-indole-3-carbonitrile |
|---|---|
| PubChem CID | 170949765 |
| Molecular Formula | C16H17N5S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 7-[(1-ethyl-2-methylimidazol-4-yl)sulfanylamino]-4-methyl-1H-indole-3-carbonitrile |
| SMILES | CCn1cc(SNc2ccc(C)c3c(C#N)c[nH]c23)nc1C |
| InChI | InChI=1S/C16H17N5S/c1-4-21-9-14(19-11(21)3)22-20-13-6-5-10(2)15-12(7-17)8-18-16(13)15/h5-6,8-9,18,20H,4H2,1-3H3 |
| InChIKey | PZJGPSUTAUDFBI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 69.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|