C13H9BrN4S2 — CID 170949865
7-[(5-bromo-1,3-thiazol-2-yl)sulfanylamino]-4-methyl-1H-indole-3-carbonitrile (PubChem CID 170949865) has the molecular formula C13H9BrN4S2 and a molecular weight of 365.28 g/mol. Its IUPAC name is 7-[(5-bromo-1,3-thiazol-2-yl)sulfanylamino]-4-methyl-1H-indole-3-carbonitrile.
| Compound Name | 7-[(5-bromo-1,3-thiazol-2-yl)sulfanylamino]-4-methyl-1H-indole-3-carbonitrile |
|---|---|
| PubChem CID | 170949865 |
| Molecular Formula | C13H9BrN4S2 |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 7-[(5-bromo-1,3-thiazol-2-yl)sulfanylamino]-4-methyl-1H-indole-3-carbonitrile |
| SMILES | Cc1ccc(NSc2ncc(Br)s2)c2[nH]cc(C#N)c12 |
| InChI | InChI=1S/C13H9BrN4S2/c1-7-2-3-9(12-11(7)8(4-15)5-16-12)18-20-13-17-6-10(14)19-13/h2-3,5-6,16,18H,1H3 |
| InChIKey | FBHKXLSOKGHWKT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|