C16H12N6S2 — CID 177228537
4-methyl-7-[[4-(1H-pyrazol-4-yl)-1,3-thiazol-2-yl]sulfanylamino]-1H-indole-3-carbonitrile (PubChem CID 177228537) has the molecular formula C16H12N6S2 and a molecular weight of 352.45 g/mol. Its IUPAC name is 4-methyl-7-[[4-(1H-pyrazol-4-yl)-1,3-thiazol-2-yl]sulfanylamino]-1H-indole-3-carbonitrile.
| Compound Name | 4-methyl-7-[[4-(1H-pyrazol-4-yl)-1,3-thiazol-2-yl]sulfanylamino]-1H-indole-3-carbonitrile |
|---|---|
| PubChem CID | 177228537 |
| Molecular Formula | C16H12N6S2 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 4-methyl-7-[[4-(1H-pyrazol-4-yl)-1,3-thiazol-2-yl]sulfanylamino]-1H-indole-3-carbonitrile |
| SMILES | Cc1ccc(NSc2nc(-c3cn[nH]c3)cs2)c2[nH]cc(C#N)c12 |
| InChI | InChI=1S/C16H12N6S2/c1-9-2-3-12(15-14(9)10(4-17)5-18-15)22-24-16-21-13(8-23-16)11-6-19-20-7-11/h2-3,5-8,18,22H,1H3,(H,19,20) |
| InChIKey | PRARRQZQALPHNT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|