C13H6F4N4S2 — CID 170949453
4-fluoro-7-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]sulfanylamino]-1H-indole-3-carbonitrile (PubChem CID 170949453) has the molecular formula C13H6F4N4S2 and a molecular weight of 358.35 g/mol. Its IUPAC name is 4-fluoro-7-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]sulfanylamino]-1H-indole-3-carbonitrile.
| Compound Name | 4-fluoro-7-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]sulfanylamino]-1H-indole-3-carbonitrile |
|---|---|
| PubChem CID | 170949453 |
| Molecular Formula | C13H6F4N4S2 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 4-fluoro-7-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]sulfanylamino]-1H-indole-3-carbonitrile |
| SMILES | N#Cc1c[nH]c2c(NSc3nc(C(F)(F)F)cs3)ccc(F)c12 |
| InChI | InChI=1S/C13H6F4N4S2/c14-7-1-2-8(11-10(7)6(3-18)4-19-11)21-23-12-20-9(5-22-12)13(15,16)17/h1-2,4-5,19,21H |
| InChIKey | ORZMYKFPYKVZSC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|