C16H14F3N3S2 — CID 177318942
4-(difluoromethyl)-7-[(5-fluorothiophen-2-yl)sulfanylamino]-1H-indole-3-carbonitrile;ethane (PubChem CID 177318942) has the molecular formula C16H14F3N3S2 and a molecular weight of 369.44 g/mol. Its IUPAC name is 4-(difluoromethyl)-7-[(5-fluorothiophen-2-yl)sulfanylamino]-1H-indole-3-carbonitrile;ethane.
| Compound Name | 4-(difluoromethyl)-7-[(5-fluorothiophen-2-yl)sulfanylamino]-1H-indole-3-carbonitrile;ethane |
|---|---|
| PubChem CID | 177318942 |
| Molecular Formula | C16H14F3N3S2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 4-(difluoromethyl)-7-[(5-fluorothiophen-2-yl)sulfanylamino]-1H-indole-3-carbonitrile;ethane |
| SMILES | CC.N#Cc1c[nH]c2c(NSc3ccc(F)s3)ccc(C(F)F)c12 |
| InChI | InChI=1S/C14H8F3N3S2.C2H6/c15-10-3-4-11(21-10)22-20-9-2-1-8(14(16)17)12-7(5-18)6-19-13(9)12;1-2/h1-4,6,14,19-20H;1-2H3 |
| InChIKey | WCTKJFVIOQRULA-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|